C21H25BN2O5 — CID 131746766
[4-[[tert-butyl-(3,5-dimethylbenzoyl)amino]carbamoyl]-2-formylphenyl]boronic acid (PubChem CID 131746766) has the molecular formula C21H25BN2O5 and a molecular weight of 396.25 g/mol. Its IUPAC name is [4-[[tert-butyl-(3,5-dimethylbenzoyl)amino]carbamoyl]-2-formylphenyl]boronic acid.
| Compound Name | [4-[[tert-butyl-(3,5-dimethylbenzoyl)amino]carbamoyl]-2-formylphenyl]boronic acid |
|---|---|
| PubChem CID | 131746766 |
| Molecular Formula | C21H25BN2O5 |
| Molecular Weight | 396.25 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | [4-[[tert-butyl-(3,5-dimethylbenzoyl)amino]carbamoyl]-2-formylphenyl]boronic acid |
| SMILES | Cc1cc(C)cc(C(=O)N(NC(=O)c2ccc(B(O)O)c(C=O)c2)C(C)(C)C)c1 |
| InChI | InChI=1S/C21H25BN2O5/c1-13-8-14(2)10-16(9-13)20(27)24(21(3,4)5)23-19(26)15-6-7-18(22(28)29)17(11-15)12-25/h6-12,28-29H,1-5H3,(H,23,26) |
| InChIKey | DNZVXSZJLLSZIL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|