C21H25BN4O3 — CID 140707502
N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-1-hydroxy-2H-2,3,1-benzodiazaborinine-6-carbohydrazide (PubChem CID 140707502) has the molecular formula C21H25BN4O3 and a molecular weight of 392.27 g/mol. Its IUPAC name is N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-1-hydroxy-2H-2,3,1-benzodiazaborinine-6-carbohydrazide.
| Compound Name | N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-1-hydroxy-2H-2,3,1-benzodiazaborinine-6-carbohydrazide |
|---|---|
| PubChem CID | 140707502 |
| Molecular Formula | C21H25BN4O3 |
| Molecular Weight | 392.27 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-1-hydroxy-2H-2,3,1-benzodiazaborinine-6-carbohydrazide |
| SMILES | Cc1cc(C)cc(C(=O)N(NC(=O)c2ccc3c(c2)C=NNB3O)C(C)(C)C)c1 |
| InChI | InChI=1S/C21H25BN4O3/c1-13-8-14(2)10-16(9-13)20(28)26(21(3,4)5)24-19(27)15-6-7-18-17(11-15)12-23-25-22(18)29/h6-12,25,29H,1-5H3,(H,24,27) |
| InChIKey | LXWUJSWUUJNQNO-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|