C21H25BN4O4 — CID 131746789
N-tert-butyl-1-hydroxy-N'-(3-methoxy-2-methylbenzoyl)-2H-2,3,1-benzodiazaborinine-7-carbohydrazide (PubChem CID 131746789) has the molecular formula C21H25BN4O4 and a molecular weight of 408.27 g/mol. Its IUPAC name is N-tert-butyl-1-hydroxy-N'-(3-methoxy-2-methylbenzoyl)-2H-2,3,1-benzodiazaborinine-7-carbohydrazide.
| Compound Name | N-tert-butyl-1-hydroxy-N'-(3-methoxy-2-methylbenzoyl)-2H-2,3,1-benzodiazaborinine-7-carbohydrazide |
|---|---|
| PubChem CID | 131746789 |
| Molecular Formula | C21H25BN4O4 |
| Molecular Weight | 408.27 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | N-tert-butyl-1-hydroxy-N'-(3-methoxy-2-methylbenzoyl)-2H-2,3,1-benzodiazaborinine-7-carbohydrazide |
| SMILES | COc1cccc(C(=O)NN(C(=O)c2ccc3c(c2)B(O)NN=C3)C(C)(C)C)c1C |
| InChI | InChI=1S/C21H25BN4O4/c1-13-16(7-6-8-18(13)30-5)19(27)24-26(21(2,3)4)20(28)14-9-10-15-12-23-25-22(29)17(15)11-14/h6-12,25,29H,1-5H3,(H,24,27) |
| InChIKey | UKOADNHPLJYVEH-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.27 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|