C26H35BN2O5 — CID 145046550
[4-[tert-butyl-[(3-methoxy-2-methylbenzoyl)amino]carbamoyl]-2-[(E)-2-methylbut-1-enyl]phenyl]-methoxyborinic acid (PubChem CID 145046550) has the molecular formula C26H35BN2O5 and a molecular weight of 466.39 g/mol. Its IUPAC name is [4-[tert-butyl-[(3-methoxy-2-methylbenzoyl)amino]carbamoyl]-2-[(E)-2-methylbut-1-enyl]phenyl]-methoxyborinic acid.
| Compound Name | [4-[tert-butyl-[(3-methoxy-2-methylbenzoyl)amino]carbamoyl]-2-[(E)-2-methylbut-1-enyl]phenyl]-methoxyborinic acid |
|---|---|
| PubChem CID | 145046550 |
| Molecular Formula | C26H35BN2O5 |
| Molecular Weight | 466.39 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | [4-[tert-butyl-[(3-methoxy-2-methylbenzoyl)amino]carbamoyl]-2-[(E)-2-methylbut-1-enyl]phenyl]-methoxyborinic acid |
| SMILES | CC/C(C)=C/c1cc(C(=O)N(NC(=O)c2cccc(OC)c2C)C(C)(C)C)ccc1B(O)OC |
| InChI | InChI=1S/C26H35BN2O5/c1-9-17(2)15-20-16-19(13-14-22(20)27(32)34-8)25(31)29(26(4,5)6)28-24(30)21-11-10-12-23(33-7)18(21)3/h10-16,32H,9H2,1-8H3,(H,28,30)/b17-15+ |
| InChIKey | AXDJKGSVSMCBFY-BMRADRMJSA-N |
| XLogP | 3.74 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|