C26H34BN3O7 — CID 140707543
N'-tert-butyl-3-methoxy-2-methyl-N'-[3-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]benzohydrazide (PubChem CID 140707543) has the molecular formula C26H34BN3O7 and a molecular weight of 511.38 g/mol. Its IUPAC name is N'-tert-butyl-3-methoxy-2-methyl-N'-[3-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]benzohydrazide.
| Compound Name | N'-tert-butyl-3-methoxy-2-methyl-N'-[3-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]benzohydrazide |
|---|---|
| PubChem CID | 140707543 |
| Molecular Formula | C26H34BN3O7 |
| Molecular Weight | 511.38 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | N'-tert-butyl-3-methoxy-2-methyl-N'-[3-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]benzohydrazide |
| SMILES | COc1cccc(C(=O)NN(C(=O)c2ccc(B3OC(C)(C)C(C)(C)O3)c([N+](=O)[O-])c2)C(C)(C)C)c1C |
| InChI | InChI=1S/C26H34BN3O7/c1-16-18(11-10-12-21(16)35-9)22(31)28-29(24(2,3)4)23(32)17-13-14-19(20(15-17)30(33)34)27-36-25(5,6)26(7,8)37-27/h10-15H,1-9H3,(H,28,31) |
| InChIKey | HIRFGGJRIQZXBJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|