C20H23N3O4 — CID 139683569
N'-tert-butyl-2,3-dimethyl-N'-(2-nitrobenzoyl)benzohydrazide (PubChem CID 139683569) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is N'-tert-butyl-2,3-dimethyl-N'-(2-nitrobenzoyl)benzohydrazide.
| Compound Name | N'-tert-butyl-2,3-dimethyl-N'-(2-nitrobenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 139683569 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | N'-tert-butyl-2,3-dimethyl-N'-(2-nitrobenzoyl)benzohydrazide |
| SMILES | Cc1cccc(C(=O)NN(C(=O)c2ccccc2[N+](=O)[O-])C(C)(C)C)c1C |
| InChI | InChI=1S/C20H23N3O4/c1-13-9-8-11-15(14(13)2)18(24)21-22(20(3,4)5)19(25)16-10-6-7-12-17(16)23(26)27/h6-12H,1-5H3,(H,21,24) |
| InChIKey | YZFSQVGUOUAOON-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|