C23H27BN4O4 — CID 131746786
2-acetyl-N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-1-hydroxy-2,3,1-benzodiazaborinine-6-carbohydrazide (PubChem CID 131746786) has the molecular formula C23H27BN4O4 and a molecular weight of 434.31 g/mol. Its IUPAC name is 2-acetyl-N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-1-hydroxy-2,3,1-benzodiazaborinine-6-carbohydrazide.
| Compound Name | 2-acetyl-N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-1-hydroxy-2,3,1-benzodiazaborinine-6-carbohydrazide |
|---|---|
| PubChem CID | 131746786 |
| Molecular Formula | C23H27BN4O4 |
| Molecular Weight | 434.31 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 2-acetyl-N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-1-hydroxy-2,3,1-benzodiazaborinine-6-carbohydrazide |
| SMILES | CC(=O)N1N=Cc2cc(C(=O)NN(C(=O)c3cc(C)cc(C)c3)C(C)(C)C)ccc2B1O |
| InChI | InChI=1S/C23H27BN4O4/c1-14-9-15(2)11-18(10-14)22(31)27(23(4,5)6)26-21(30)17-7-8-20-19(12-17)13-25-28(16(3)29)24(20)32/h7-13,32H,1-6H3,(H,26,30) |
| InChIKey | ZBHMBIZMNYYTMF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|