C23H30BFN2O4 — CID 86280712
[4-[[[3,5-bis(trideuteriomethyl)benzoyl]-[(3R)-2,2-dimethylpentan-3-yl]amino]carbamoyl]-3-fluorophenyl]boronic acid (PubChem CID 86280712) has the molecular formula C23H30BFN2O4 and a molecular weight of 434.35 g/mol. Its IUPAC name is [4-[[[3,5-bis(trideuteriomethyl)benzoyl]-[(3R)-2,2-dimethylpentan-3-yl]amino]carbamoyl]-3-fluorophenyl]boronic acid.
| Compound Name | [4-[[[3,5-bis(trideuteriomethyl)benzoyl]-[(3R)-2,2-dimethylpentan-3-yl]amino]carbamoyl]-3-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 86280712 |
| Molecular Formula | C23H30BFN2O4 |
| Molecular Weight | 434.35 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | [4-[[[3,5-bis(trideuteriomethyl)benzoyl]-[(3R)-2,2-dimethylpentan-3-yl]amino]carbamoyl]-3-fluorophenyl]boronic acid |
| SMILES | [2H]C([2H])([2H])c1cc(C(=O)N(NC(=O)c2ccc(B(O)O)cc2F)[C@H](CC)C(C)(C)C)cc(C([2H])([2H])[2H])c1 |
| InChI | InChI=1S/C23H30BFN2O4/c1-7-20(23(4,5)6)27(22(29)16-11-14(2)10-15(3)12-16)26-21(28)18-9-8-17(24(30)31)13-19(18)25/h8-13,20,30-31H,7H2,1-6H3,(H,26,28)/t20-/m1/s1/i2D3,3D3 |
| InChIKey | DHFWUILSJZRHHW-HMKMWLAXSA-N |
| XLogP | 2.73 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|