C35H62BFN10O8 — CID 155640883
[3-fluoro-4-[2-[[4,6,8,10-tetrakis(2-aminoethylcarbamoyl)-2-ethyldodecanoyl]amino]ethylcarbamoyl]phenyl]boronic acid (PubChem CID 155640883) has the molecular formula C35H62BFN10O8 and a molecular weight of 780.75 g/mol. Its IUPAC name is [3-fluoro-4-[2-[[4,6,8,10-tetrakis(2-aminoethylcarbamoyl)-2-ethyldodecanoyl]amino]ethylcarbamoyl]phenyl]boronic acid.
| Compound Name | [3-fluoro-4-[2-[[4,6,8,10-tetrakis(2-aminoethylcarbamoyl)-2-ethyldodecanoyl]amino]ethylcarbamoyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 155640883 |
| Molecular Formula | C35H62BFN10O8 |
| Molecular Weight | 780.75 g/mol |
| Exact Mass | 780.48 |
| IUPAC Name | [3-fluoro-4-[2-[[4,6,8,10-tetrakis(2-aminoethylcarbamoyl)-2-ethyldodecanoyl]amino]ethylcarbamoyl]phenyl]boronic acid |
| SMILES | CCC(CC(CC(CC(CC(CC)C(=O)NCCNC(=O)c1ccc(B(O)O)cc1F)C(=O)NCCN)C(=O)NCCN)C(=O)NCCN)C(=O)NCCN |
| InChI | InChI=1S/C35H62BFN10O8/c1-3-22(30(48)42-11-7-38)17-24(32(50)43-12-8-39)19-26(34(52)45-14-10-41)20-25(33(51)44-13-9-40)18-23(4-2)31(49)46-15-16-47-35(53)28-6-5-27(36(54)55)21-29(28)37/h5-6,21-26,54-55H,3-4,7-20,38-41H2,1-2H3,(H,42,48)(H,43,50)(H,44,51)(H,45,52)(H,46,49)(H,47,53) |
| InChIKey | UZKXPCFIAVTNCW-UHFFFAOYSA-N |
| XLogP | -3.89 |
| TPSA | 319.14 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.75 |
| LogP ≤ 5 | -3.89 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|