About [4-[(2,2-difluoro-1-phenylethyl)carbamoyl]-3-fluorophenyl]boronic acid
[4-[(2,2-difluoro-1-phenylethyl)carbamoyl]-3-fluorophenyl]boronic acid (PubChem CID 123534983) has the molecular formula C15H13BF3NO3
and a molecular weight of 323.08 g/mol. Its IUPAC name is [4-[(2,2-difluoro-1-phenylethyl)carbamoyl]-3-fluorophenyl]boronic acid.
Molecular Properties
| Compound Name | [4-[(2,2-difluoro-1-phenylethyl)carbamoyl]-3-fluorophenyl]boronic acid |
| PubChem CID | 123534983 |
| Molecular Formula | C15H13BF3NO3 |
| Molecular Weight | 323.08 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | [4-[(2,2-difluoro-1-phenylethyl)carbamoyl]-3-fluorophenyl]boronic acid |
| SMILES | O=C(NC(c1ccccc1)C(F)F)c1ccc(B(O)O)cc1F |
| InChI | InChI=1S/C15H13BF3NO3/c17-12-8-10(16(22)23)6-7-11(12)15(21)20-13(14(18)19)9-4-2-1-3-5-9/h1-8,13-14,22-23H,(H,20,21) |
| InChIKey | PNENETKVSMVROS-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.08 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [4-[(2,2-difluoro-1-phenylethyl)carbamoyl]-3-fluorophenyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2,2-difluoro-1-phenylethyl)carbamoyl]-3-fluorophenyl]boronic acid?
The IUPAC name of [4-[(2,2-difluoro-1-phenylethyl)carbamoyl]-3-fluorophenyl]boronic acid (CID 123534983) is [4-[(2,2-difluoro-1-phenylethyl)carbamoyl]-3-fluorophenyl]boronic acid.
What is the SMILES notation for [4-[(2,2-difluoro-1-phenylethyl)carbamoyl]-3-fluorophenyl]boronic acid?
The canonical SMILES for [4-[(2,2-difluoro-1-phenylethyl)carbamoyl]-3-fluorophenyl]boronic acid is O=C(NC(c1ccccc1)C(F)F)c1ccc(B(O)O)cc1F.
What is the InChIKey of [4-[(2,2-difluoro-1-phenylethyl)carbamoyl]-3-fluorophenyl]boronic acid?
The InChIKey is PNENETKVSMVROS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13BF3NO3/c17-12-8-10(16(22)23)6-7-11(12)15(21)20-13(14(18)19)9-4-2-1-3-5-9/h1-8,13-14,22-23H,(H,20,21).
What are the key properties of [4-[(2,2-difluoro-1-phenylethyl)carbamoyl]-3-fluorophenyl]boronic acid?
[4-[(2,2-difluoro-1-phenylethyl)carbamoyl]-3-fluorophenyl]boronic acid has a molecular weight of 323.08 g/mol, XLogP of 1.24, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2,2-difluoro-1-phenylethyl)carbamoyl]-3-fluorophenyl]boronic acid is sourced from PubChem (CID 123534983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).