C27H30BFN2O4 — CID 86280849
[4-[[[3,5-bis(trideuteriomethyl)benzoyl]-(2,2-dimethyl-1-phenylpropyl)amino]carbamoyl]-3-fluorophenyl]boronic acid (PubChem CID 86280849) has the molecular formula C27H30BFN2O4 and a molecular weight of 482.39 g/mol. Its IUPAC name is [4-[[[3,5-bis(trideuteriomethyl)benzoyl]-(2,2-dimethyl-1-phenylpropyl)amino]carbamoyl]-3-fluorophenyl]boronic acid.
| Compound Name | [4-[[[3,5-bis(trideuteriomethyl)benzoyl]-(2,2-dimethyl-1-phenylpropyl)amino]carbamoyl]-3-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 86280849 |
| Molecular Formula | C27H30BFN2O4 |
| Molecular Weight | 482.39 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | [4-[[[3,5-bis(trideuteriomethyl)benzoyl]-(2,2-dimethyl-1-phenylpropyl)amino]carbamoyl]-3-fluorophenyl]boronic acid |
| SMILES | [2H]C([2H])([2H])c1cc(C(=O)N(NC(=O)c2ccc(B(O)O)cc2F)C(c2ccccc2)C(C)(C)C)cc(C([2H])([2H])[2H])c1 |
| InChI | InChI=1S/C27H30BFN2O4/c1-17-13-18(2)15-20(14-17)26(33)31(24(27(3,4)5)19-9-7-6-8-10-19)30-25(32)22-12-11-21(28(34)35)16-23(22)29/h6-16,24,34-35H,1-5H3,(H,30,32)/i1D3,2D3 |
| InChIKey | BHMRXVSSLMWENQ-WFGJKAKNSA-N |
| XLogP | 3.70 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|