C31H52BFN2O7 — CID 167698344
[4-[[9-ethyl-5-[2-(2-methoxyethoxy)ethylcarbamoyl]-7,7-dimethyl-8-oxotetradecyl]carbamoyl]-3-fluorophenyl]boronic acid (PubChem CID 167698344) has the molecular formula C31H52BFN2O7 and a molecular weight of 594.57 g/mol. Its IUPAC name is [4-[[9-ethyl-5-[2-(2-methoxyethoxy)ethylcarbamoyl]-7,7-dimethyl-8-oxotetradecyl]carbamoyl]-3-fluorophenyl]boronic acid.
| Compound Name | [4-[[9-ethyl-5-[2-(2-methoxyethoxy)ethylcarbamoyl]-7,7-dimethyl-8-oxotetradecyl]carbamoyl]-3-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 167698344 |
| Molecular Formula | C31H52BFN2O7 |
| Molecular Weight | 594.57 g/mol |
| Exact Mass | 594.39 |
| IUPAC Name | [4-[[9-ethyl-5-[2-(2-methoxyethoxy)ethylcarbamoyl]-7,7-dimethyl-8-oxotetradecyl]carbamoyl]-3-fluorophenyl]boronic acid |
| SMILES | CCCCCC(CC)C(=O)C(C)(C)CC(CCCCNC(=O)c1ccc(B(O)O)cc1F)C(=O)NCCOCCOC |
| InChI | InChI=1S/C31H52BFN2O7/c1-6-8-9-12-23(7-2)28(36)31(3,4)22-24(29(37)35-17-18-42-20-19-41-5)13-10-11-16-34-30(38)26-15-14-25(32(39)40)21-27(26)33/h14-15,21,23-24,39-40H,6-13,16-20,22H2,1-5H3,(H,34,38)(H,35,37) |
| InChIKey | SLUQRNVLFSNXNI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.57 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|