C11H14Cl2N2O — CID 57207833
N-tert-butyl-N',4-dichlorobenzohydrazide (PubChem CID 57207833) has the molecular formula C11H14Cl2N2O and a molecular weight of 261.15 g/mol. Its IUPAC name is N-tert-butyl-N',4-dichlorobenzohydrazide.
| Compound Name | N-tert-butyl-N',4-dichlorobenzohydrazide |
|---|---|
| PubChem CID | 57207833 |
| Molecular Formula | C11H14Cl2N2O |
| Molecular Weight | 261.15 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | N-tert-butyl-N',4-dichlorobenzohydrazide |
| SMILES | CC(C)(C)N(NCl)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H14Cl2N2O/c1-11(2,3)15(14-13)10(16)8-4-6-9(12)7-5-8/h4-7,14H,1-3H3 |
| InChIKey | VDVXDUYALIQUSA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.15 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|