C15H23ClN2O — CID 57155431
N,4-ditert-butyl-N'-chlorobenzohydrazide (PubChem CID 57155431) has the molecular formula C15H23ClN2O and a molecular weight of 282.81 g/mol. Its IUPAC name is N,4-ditert-butyl-N'-chlorobenzohydrazide.
| Compound Name | N,4-ditert-butyl-N'-chlorobenzohydrazide |
|---|---|
| PubChem CID | 57155431 |
| Molecular Formula | C15H23ClN2O |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | N,4-ditert-butyl-N'-chlorobenzohydrazide |
| SMILES | CC(C)(C)c1ccc(C(=O)N(NCl)C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H23ClN2O/c1-14(2,3)12-9-7-11(8-10-12)13(19)18(17-16)15(4,5)6/h7-10,17H,1-6H3 |
| InChIKey | LRPBHDROCADMRT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|