C17H28N2O — CID 163788626
4-tert-butyl-N,N'-di(propan-2-yl)benzohydrazide (PubChem CID 163788626) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is 4-tert-butyl-N,N'-di(propan-2-yl)benzohydrazide.
| Compound Name | 4-tert-butyl-N,N'-di(propan-2-yl)benzohydrazide |
|---|---|
| PubChem CID | 163788626 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 4-tert-butyl-N,N'-di(propan-2-yl)benzohydrazide |
| SMILES | CC(C)NN(C(=O)c1ccc(C(C)(C)C)cc1)C(C)C |
| InChI | InChI=1S/C17H28N2O/c1-12(2)18-19(13(3)4)16(20)14-8-10-15(11-9-14)17(5,6)7/h8-13,18H,1-7H3 |
| InChIKey | MUTCQONFAFYCSQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|