C18H17Cl3FN3O2 — CID 134112760
1-[tert-butyl-(3,5-dichlorobenzoyl)amino]-3-(5-chloro-2-fluorophenyl)urea (PubChem CID 134112760) has the molecular formula C18H17Cl3FN3O2 and a molecular weight of 432.71 g/mol. Its IUPAC name is 1-[tert-butyl-(3,5-dichlorobenzoyl)amino]-3-(5-chloro-2-fluorophenyl)urea.
| Compound Name | 1-[tert-butyl-(3,5-dichlorobenzoyl)amino]-3-(5-chloro-2-fluorophenyl)urea |
|---|---|
| PubChem CID | 134112760 |
| Molecular Formula | C18H17Cl3FN3O2 |
| Molecular Weight | 432.71 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | 1-[tert-butyl-(3,5-dichlorobenzoyl)amino]-3-(5-chloro-2-fluorophenyl)urea |
| SMILES | CC(C)(C)N(NC(=O)Nc1cc(Cl)ccc1F)C(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H17Cl3FN3O2/c1-18(2,3)25(16(26)10-6-12(20)8-13(21)7-10)24-17(27)23-15-9-11(19)4-5-14(15)22/h4-9H,1-3H3,(H2,23,24,27) |
| InChIKey | RHCFRNRRZISIQG-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.71 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|