About 1-[tert-butyl-(3,5-dichlorobenzoyl)amino]-3-(5-chloro-2-fluorophenyl)urea
1-[tert-butyl-(3,5-dichlorobenzoyl)amino]-3-(5-chloro-2-fluorophenyl)urea (PubChem CID 134112760) has the molecular formula C18H17Cl3FN3O2
and a molecular weight of 432.71 g/mol. Its IUPAC name is 1-[tert-butyl-(3,5-dichlorobenzoyl)amino]-3-(5-chloro-2-fluorophenyl)urea.
Molecular Properties
| Compound Name | 1-[tert-butyl-(3,5-dichlorobenzoyl)amino]-3-(5-chloro-2-fluorophenyl)urea |
| PubChem CID | 134112760 |
| Molecular Formula | C18H17Cl3FN3O2 |
| Molecular Weight | 432.71 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | 1-[tert-butyl-(3,5-dichlorobenzoyl)amino]-3-(5-chloro-2-fluorophenyl)urea |
| SMILES | CC(C)(C)N(NC(=O)Nc1cc(Cl)ccc1F)C(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H17Cl3FN3O2/c1-18(2,3)25(16(26)10-6-12(20)8-13(21)7-10)24-17(27)23-15-9-11(19)4-5-14(15)22/h4-9H,1-3H3,(H2,23,24,27) |
| InChIKey | RHCFRNRRZISIQG-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.71 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[tert-butyl-(3,5-dichlorobenzoyl)amino]-3-(5-chloro-2-fluorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[tert-butyl-(3,5-dichlorobenzoyl)amino]-3-(5-chloro-2-fluorophenyl)urea?
The IUPAC name of 1-[tert-butyl-(3,5-dichlorobenzoyl)amino]-3-(5-chloro-2-fluorophenyl)urea (CID 134112760) is 1-[tert-butyl-(3,5-dichlorobenzoyl)amino]-3-(5-chloro-2-fluorophenyl)urea.
What is the SMILES notation for 1-[tert-butyl-(3,5-dichlorobenzoyl)amino]-3-(5-chloro-2-fluorophenyl)urea?
The canonical SMILES for 1-[tert-butyl-(3,5-dichlorobenzoyl)amino]-3-(5-chloro-2-fluorophenyl)urea is CC(C)(C)N(NC(=O)Nc1cc(Cl)ccc1F)C(=O)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of 1-[tert-butyl-(3,5-dichlorobenzoyl)amino]-3-(5-chloro-2-fluorophenyl)urea?
The InChIKey is RHCFRNRRZISIQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17Cl3FN3O2/c1-18(2,3)25(16(26)10-6-12(20)8-13(21)7-10)24-17(27)23-15-9-11(19)4-5-14(15)22/h4-9H,1-3H3,(H2,23,24,27).
What are the key properties of 1-[tert-butyl-(3,5-dichlorobenzoyl)amino]-3-(5-chloro-2-fluorophenyl)urea?
1-[tert-butyl-(3,5-dichlorobenzoyl)amino]-3-(5-chloro-2-fluorophenyl)urea has a molecular weight of 432.71 g/mol, XLogP of 5.76, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[tert-butyl-(3,5-dichlorobenzoyl)amino]-3-(5-chloro-2-fluorophenyl)urea is sourced from PubChem (CID 134112760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).