C24H23Cl2F2N3O2 — CID 134113326
1-[1-adamantyl-(3,5-dichlorobenzoyl)amino]-3-(2,5-difluorophenyl)urea (PubChem CID 134113326) has the molecular formula C24H23Cl2F2N3O2 and a molecular weight of 494.37 g/mol. Its IUPAC name is 1-[1-adamantyl-(3,5-dichlorobenzoyl)amino]-3-(2,5-difluorophenyl)urea.
| Compound Name | 1-[1-adamantyl-(3,5-dichlorobenzoyl)amino]-3-(2,5-difluorophenyl)urea |
|---|---|
| PubChem CID | 134113326 |
| Molecular Formula | C24H23Cl2F2N3O2 |
| Molecular Weight | 494.37 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | 1-[1-adamantyl-(3,5-dichlorobenzoyl)amino]-3-(2,5-difluorophenyl)urea |
| SMILES | O=C(Nc1cc(F)ccc1F)NN(C(=O)c1cc(Cl)cc(Cl)c1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H23Cl2F2N3O2/c25-17-6-16(7-18(26)8-17)22(32)31(24-10-13-3-14(11-24)5-15(4-13)12-24)30-23(33)29-21-9-19(27)1-2-20(21)28/h1-2,6-9,13-15H,3-5,10-12H2,(H2,29,30,33) |
| InChIKey | ORXCOMOCVTXUNZ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.37 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|