C14H9Cl2F2N3O2 — CID 3637073
1-[(2,4-dichlorobenzoyl)amino]-3-(2,4-difluorophenyl)urea (PubChem CID 3637073) has the molecular formula C14H9Cl2F2N3O2 and a molecular weight of 360.15 g/mol. Its IUPAC name is 1-[(2,4-dichlorobenzoyl)amino]-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-[(2,4-dichlorobenzoyl)amino]-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 3637073 |
| Molecular Formula | C14H9Cl2F2N3O2 |
| Molecular Weight | 360.15 g/mol |
| Exact Mass | 359.00 |
| IUPAC Name | 1-[(2,4-dichlorobenzoyl)amino]-3-(2,4-difluorophenyl)urea |
| SMILES | O=C(NNC(=O)c1ccc(Cl)cc1Cl)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C14H9Cl2F2N3O2/c15-7-1-3-9(10(16)5-7)13(22)20-21-14(23)19-12-4-2-8(17)6-11(12)18/h1-6H,(H,20,22)(H2,19,21,23) |
| InChIKey | JTPCZBJZAMJCDY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.15 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|