C20H19Cl2F2N3O2 — CID 134090747
1-[cyclohexyl-(3,5-dichlorobenzoyl)amino]-3-(2,5-difluorophenyl)urea (PubChem CID 134090747) has the molecular formula C20H19Cl2F2N3O2 and a molecular weight of 442.29 g/mol. Its IUPAC name is 1-[cyclohexyl-(3,5-dichlorobenzoyl)amino]-3-(2,5-difluorophenyl)urea.
| Compound Name | 1-[cyclohexyl-(3,5-dichlorobenzoyl)amino]-3-(2,5-difluorophenyl)urea |
|---|---|
| PubChem CID | 134090747 |
| Molecular Formula | C20H19Cl2F2N3O2 |
| Molecular Weight | 442.29 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | 1-[cyclohexyl-(3,5-dichlorobenzoyl)amino]-3-(2,5-difluorophenyl)urea |
| SMILES | O=C(Nc1cc(F)ccc1F)NN(C(=O)c1cc(Cl)cc(Cl)c1)C1CCCCC1 |
| InChI | InChI=1S/C20H19Cl2F2N3O2/c21-13-8-12(9-14(22)10-13)19(28)27(16-4-2-1-3-5-16)26-20(29)25-18-11-15(23)6-7-17(18)24/h6-11,16H,1-5H2,(H2,25,26,29) |
| InChIKey | GJWPGLHEVBZUOH-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.29 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|