About 1-[tert-butyl-(3-chloro-5-methylbenzoyl)amino]-3-(2,5-difluorophenyl)urea
1-[tert-butyl-(3-chloro-5-methylbenzoyl)amino]-3-(2,5-difluorophenyl)urea (PubChem CID 134093524) has the molecular formula C19H20ClF2N3O2
and a molecular weight of 395.84 g/mol. Its IUPAC name is 1-[tert-butyl-(3-chloro-5-methylbenzoyl)amino]-3-(2,5-difluorophenyl)urea.
Molecular Properties
| Compound Name | 1-[tert-butyl-(3-chloro-5-methylbenzoyl)amino]-3-(2,5-difluorophenyl)urea |
| PubChem CID | 134093524 |
| Molecular Formula | C19H20ClF2N3O2 |
| Molecular Weight | 395.84 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 1-[tert-butyl-(3-chloro-5-methylbenzoyl)amino]-3-(2,5-difluorophenyl)urea |
| SMILES | Cc1cc(Cl)cc(C(=O)N(NC(=O)Nc2cc(F)ccc2F)C(C)(C)C)c1 |
| InChI | InChI=1S/C19H20ClF2N3O2/c1-11-7-12(9-13(20)8-11)17(26)25(19(2,3)4)24-18(27)23-16-10-14(21)5-6-15(16)22/h5-10H,1-4H3,(H2,23,24,27) |
| InChIKey | LZMYRXNCBUMLHV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.84 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[tert-butyl-(3-chloro-5-methylbenzoyl)amino]-3-(2,5-difluorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[tert-butyl-(3-chloro-5-methylbenzoyl)amino]-3-(2,5-difluorophenyl)urea?
The IUPAC name of 1-[tert-butyl-(3-chloro-5-methylbenzoyl)amino]-3-(2,5-difluorophenyl)urea (CID 134093524) is 1-[tert-butyl-(3-chloro-5-methylbenzoyl)amino]-3-(2,5-difluorophenyl)urea.
What is the SMILES notation for 1-[tert-butyl-(3-chloro-5-methylbenzoyl)amino]-3-(2,5-difluorophenyl)urea?
The canonical SMILES for 1-[tert-butyl-(3-chloro-5-methylbenzoyl)amino]-3-(2,5-difluorophenyl)urea is Cc1cc(Cl)cc(C(=O)N(NC(=O)Nc2cc(F)ccc2F)C(C)(C)C)c1.
What is the InChIKey of 1-[tert-butyl-(3-chloro-5-methylbenzoyl)amino]-3-(2,5-difluorophenyl)urea?
The InChIKey is LZMYRXNCBUMLHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20ClF2N3O2/c1-11-7-12(9-13(20)8-11)17(26)25(19(2,3)4)24-18(27)23-16-10-14(21)5-6-15(16)22/h5-10H,1-4H3,(H2,23,24,27).
What are the key properties of 1-[tert-butyl-(3-chloro-5-methylbenzoyl)amino]-3-(2,5-difluorophenyl)urea?
1-[tert-butyl-(3-chloro-5-methylbenzoyl)amino]-3-(2,5-difluorophenyl)urea has a molecular weight of 395.84 g/mol, XLogP of 4.90, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[tert-butyl-(3-chloro-5-methylbenzoyl)amino]-3-(2,5-difluorophenyl)urea is sourced from PubChem (CID 134093524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).