C20H23F2N3O2 — CID 134103992
1-[tert-butyl-(3,5-dimethylbenzoyl)amino]-3-(2,4-difluorophenyl)urea (PubChem CID 134103992) has the molecular formula C20H23F2N3O2 and a molecular weight of 375.42 g/mol. Its IUPAC name is 1-[tert-butyl-(3,5-dimethylbenzoyl)amino]-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-[tert-butyl-(3,5-dimethylbenzoyl)amino]-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 134103992 |
| Molecular Formula | C20H23F2N3O2 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 1-[tert-butyl-(3,5-dimethylbenzoyl)amino]-3-(2,4-difluorophenyl)urea |
| SMILES | Cc1cc(C)cc(C(=O)N(NC(=O)Nc2ccc(F)cc2F)C(C)(C)C)c1 |
| InChI | InChI=1S/C20H23F2N3O2/c1-12-8-13(2)10-14(9-12)18(26)25(20(3,4)5)24-19(27)23-17-7-6-15(21)11-16(17)22/h6-11H,1-5H3,(H2,23,24,27) |
| InChIKey | LCMZFMUMXBAPSI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|