C18H16Cl3F2N3O2 — CID 134103965
1-[tert-butyl-(3,4,5-trichlorobenzoyl)amino]-3-(2,5-difluorophenyl)urea (PubChem CID 134103965) has the molecular formula C18H16Cl3F2N3O2 and a molecular weight of 450.70 g/mol. Its IUPAC name is 1-[tert-butyl-(3,4,5-trichlorobenzoyl)amino]-3-(2,5-difluorophenyl)urea.
| Compound Name | 1-[tert-butyl-(3,4,5-trichlorobenzoyl)amino]-3-(2,5-difluorophenyl)urea |
|---|---|
| PubChem CID | 134103965 |
| Molecular Formula | C18H16Cl3F2N3O2 |
| Molecular Weight | 450.70 g/mol |
| Exact Mass | 449.03 |
| IUPAC Name | 1-[tert-butyl-(3,4,5-trichlorobenzoyl)amino]-3-(2,5-difluorophenyl)urea |
| SMILES | CC(C)(C)N(NC(=O)Nc1cc(F)ccc1F)C(=O)c1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H16Cl3F2N3O2/c1-18(2,3)26(16(27)9-6-11(19)15(21)12(20)7-9)25-17(28)24-14-8-10(22)4-5-13(14)23/h4-8H,1-3H3,(H2,24,25,28) |
| InChIKey | BHHIBWSWRJZGCS-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.70 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|