C18H18Cl2FN3O2 — CID 140969461
1-tert-butyl-1-[(4-chlorobenzoyl)amino]-3-(3-chloro-4-fluorophenyl)urea (PubChem CID 140969461) has the molecular formula C18H18Cl2FN3O2 and a molecular weight of 398.27 g/mol. Its IUPAC name is 1-tert-butyl-1-[(4-chlorobenzoyl)amino]-3-(3-chloro-4-fluorophenyl)urea.
| Compound Name | 1-tert-butyl-1-[(4-chlorobenzoyl)amino]-3-(3-chloro-4-fluorophenyl)urea |
|---|---|
| PubChem CID | 140969461 |
| Molecular Formula | C18H18Cl2FN3O2 |
| Molecular Weight | 398.27 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 1-tert-butyl-1-[(4-chlorobenzoyl)amino]-3-(3-chloro-4-fluorophenyl)urea |
| SMILES | CC(C)(C)N(NC(=O)c1ccc(Cl)cc1)C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C18H18Cl2FN3O2/c1-18(2,3)24(23-16(25)11-4-6-12(19)7-5-11)17(26)22-13-8-9-15(21)14(20)10-13/h4-10H,1-3H3,(H,22,26)(H,23,25) |
| InChIKey | PSTQXUPLKNUGGW-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.27 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|