C16H23Cl2N3O2 — CID 134125384
1-butyl-3-[tert-butyl-(3,5-dichlorobenzoyl)amino]urea (PubChem CID 134125384) has the molecular formula C16H23Cl2N3O2 and a molecular weight of 360.29 g/mol. Its IUPAC name is 1-butyl-3-[tert-butyl-(3,5-dichlorobenzoyl)amino]urea.
| Compound Name | 1-butyl-3-[tert-butyl-(3,5-dichlorobenzoyl)amino]urea |
|---|---|
| PubChem CID | 134125384 |
| Molecular Formula | C16H23Cl2N3O2 |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 1-butyl-3-[tert-butyl-(3,5-dichlorobenzoyl)amino]urea |
| SMILES | CCCCNC(=O)NN(C(=O)c1cc(Cl)cc(Cl)c1)C(C)(C)C |
| InChI | InChI=1S/C16H23Cl2N3O2/c1-5-6-7-19-15(23)20-21(16(2,3)4)14(22)11-8-12(17)10-13(18)9-11/h8-10H,5-7H2,1-4H3,(H2,19,20,23) |
| InChIKey | CKYPVKCJZGZUBM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|