C18H26ClN3O4 — CID 134113441
tert-butyl N-[tert-butyl-[3-chloro-5-(methylcarbamoyl)benzoyl]amino]carbamate (PubChem CID 134113441) has the molecular formula C18H26ClN3O4 and a molecular weight of 383.88 g/mol. Its IUPAC name is tert-butyl N-[tert-butyl-[3-chloro-5-(methylcarbamoyl)benzoyl]amino]carbamate.
| Compound Name | tert-butyl N-[tert-butyl-[3-chloro-5-(methylcarbamoyl)benzoyl]amino]carbamate |
|---|---|
| PubChem CID | 134113441 |
| Molecular Formula | C18H26ClN3O4 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | tert-butyl N-[tert-butyl-[3-chloro-5-(methylcarbamoyl)benzoyl]amino]carbamate |
| SMILES | CNC(=O)c1cc(Cl)cc(C(=O)N(NC(=O)OC(C)(C)C)C(C)(C)C)c1 |
| InChI | InChI=1S/C18H26ClN3O4/c1-17(2,3)22(21-16(25)26-18(4,5)6)15(24)12-8-11(14(23)20-7)9-13(19)10-12/h8-10H,1-7H3,(H,20,23)(H,21,25) |
| InChIKey | SLHPKMNJSZEITK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|