C18H25Cl2N3O2 — CID 134113406
1-[tert-butyl-(3,5-dichlorobenzoyl)amino]-3-cyclohexylurea (PubChem CID 134113406) has the molecular formula C18H25Cl2N3O2 and a molecular weight of 386.32 g/mol. Its IUPAC name is 1-[tert-butyl-(3,5-dichlorobenzoyl)amino]-3-cyclohexylurea.
| Compound Name | 1-[tert-butyl-(3,5-dichlorobenzoyl)amino]-3-cyclohexylurea |
|---|---|
| PubChem CID | 134113406 |
| Molecular Formula | C18H25Cl2N3O2 |
| Molecular Weight | 386.32 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 1-[tert-butyl-(3,5-dichlorobenzoyl)amino]-3-cyclohexylurea |
| SMILES | CC(C)(C)N(NC(=O)NC1CCCCC1)C(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H25Cl2N3O2/c1-18(2,3)23(16(24)12-9-13(19)11-14(20)10-12)22-17(25)21-15-7-5-4-6-8-15/h9-11,15H,4-8H2,1-3H3,(H2,21,22,25) |
| InChIKey | OECOPVGRHQASPK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.32 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|