C13H17ClN2O3 — CID 65142598
tert-butyl N-[2-chloro-5-(methylcarbamoyl)phenyl]carbamate (PubChem CID 65142598) has the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. Its IUPAC name is tert-butyl N-[2-chloro-5-(methylcarbamoyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-chloro-5-(methylcarbamoyl)phenyl]carbamate |
|---|---|
| PubChem CID | 65142598 |
| Molecular Formula | C13H17ClN2O3 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | tert-butyl N-[2-chloro-5-(methylcarbamoyl)phenyl]carbamate |
| SMILES | CNC(=O)c1ccc(Cl)c(NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C13H17ClN2O3/c1-13(2,3)19-12(18)16-10-7-8(11(17)15-4)5-6-9(10)14/h5-7H,1-4H3,(H,15,17)(H,16,18) |
| InChIKey | YYBVRDDMZBSJJA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |