C14H20ClNO3 — CID 117114508
tert-butyl N-[2-chloro-5-(2-hydroxypropyl)phenyl]carbamate (PubChem CID 117114508) has the molecular formula C14H20ClNO3 and a molecular weight of 285.77 g/mol. Its IUPAC name is tert-butyl N-[2-chloro-5-(2-hydroxypropyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-chloro-5-(2-hydroxypropyl)phenyl]carbamate |
|---|---|
| PubChem CID | 117114508 |
| Molecular Formula | C14H20ClNO3 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | tert-butyl N-[2-chloro-5-(2-hydroxypropyl)phenyl]carbamate |
| SMILES | CC(O)Cc1ccc(Cl)c(NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C14H20ClNO3/c1-9(17)7-10-5-6-11(15)12(8-10)16-13(18)19-14(2,3)4/h5-6,8-9,17H,7H2,1-4H3,(H,16,18) |
| InChIKey | NVGWLLAPUMEDEK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |