C15H20ClNO3 — CID 117107577
tert-butyl N-[2-chloro-5-(4-oxobutan-2-yl)phenyl]carbamate (PubChem CID 117107577) has the molecular formula C15H20ClNO3 and a molecular weight of 297.78 g/mol. Its IUPAC name is tert-butyl N-[2-chloro-5-(4-oxobutan-2-yl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-chloro-5-(4-oxobutan-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 117107577 |
| Molecular Formula | C15H20ClNO3 |
| Molecular Weight | 297.78 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | tert-butyl N-[2-chloro-5-(4-oxobutan-2-yl)phenyl]carbamate |
| SMILES | CC(CC=O)c1ccc(Cl)c(NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C15H20ClNO3/c1-10(7-8-18)11-5-6-12(16)13(9-11)17-14(19)20-15(2,3)4/h5-6,8-10H,7H2,1-4H3,(H,17,19) |
| InChIKey | MAHMLIKLLPPCKX-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.78 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|