C11H18N2O2 — CID 170828089
3-amino-1-[4-(2-aminoethyl)phenyl]propane-1,2-diol (PubChem CID 170828089) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 3-amino-1-[4-(2-aminoethyl)phenyl]propane-1,2-diol.
| Compound Name | 3-amino-1-[4-(2-aminoethyl)phenyl]propane-1,2-diol |
|---|---|
| PubChem CID | 170828089 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 3-amino-1-[4-(2-aminoethyl)phenyl]propane-1,2-diol |
| SMILES | NCCc1ccc(C(O)C(O)CN)cc1 |
| InChI | InChI=1S/C11H18N2O2/c12-6-5-8-1-3-9(4-2-8)11(15)10(14)7-13/h1-4,10-11,14-15H,5-7,12-13H2 |
| InChIKey | DVCNHAVBTGGWIZ-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |