C15H17N3O6 — CID 140868152
(Z)-2-cyano-3-(3,4-dimethoxy-5-nitrophenyl)-3-hydroxy-N-propylprop-2-enamide (PubChem CID 140868152) has the molecular formula C15H17N3O6 and a molecular weight of 335.32 g/mol. Its IUPAC name is (Z)-2-cyano-3-(3,4-dimethoxy-5-nitrophenyl)-3-hydroxy-N-propylprop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(3,4-dimethoxy-5-nitrophenyl)-3-hydroxy-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 140868152 |
| Molecular Formula | C15H17N3O6 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | (Z)-2-cyano-3-(3,4-dimethoxy-5-nitrophenyl)-3-hydroxy-N-propylprop-2-enamide |
| SMILES | CCCNC(=O)/C(C#N)=C(\O)c1cc(OC)c(OC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H17N3O6/c1-4-5-17-15(20)10(8-16)13(19)9-6-11(18(21)22)14(24-3)12(7-9)23-2/h6-7,19H,4-5H2,1-3H3,(H,17,20)/b13-10- |
| InChIKey | MPIVVJYIQBWHDN-RAXLEYEMSA-N |
| XLogP | 1.93 |
| TPSA | 134.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|