C14H19N5O5 — CID 132593791
4-(2,6-dimethylpiperidin-1-yl)-3,5-dinitrobenzohydrazide (PubChem CID 132593791) has the molecular formula C14H19N5O5 and a molecular weight of 337.34 g/mol. Its IUPAC name is 4-(2,6-dimethylpiperidin-1-yl)-3,5-dinitrobenzohydrazide.
| Compound Name | 4-(2,6-dimethylpiperidin-1-yl)-3,5-dinitrobenzohydrazide |
|---|---|
| PubChem CID | 132593791 |
| Molecular Formula | C14H19N5O5 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 4-(2,6-dimethylpiperidin-1-yl)-3,5-dinitrobenzohydrazide |
| SMILES | CC1CCCC(C)N1c1c([N+](=O)[O-])cc(C(=O)NN)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H19N5O5/c1-8-4-3-5-9(2)17(8)13-11(18(21)22)6-10(14(20)16-15)7-12(13)19(23)24/h6-9H,3-5,15H2,1-2H3,(H,16,20) |
| InChIKey | QWAAQTXDSHIVNV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 144.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|