C14H18N4O6 — CID 132593728
N-hydroxy-4-[(2-methylcyclohexyl)amino]-3,5-dinitrobenzamide (PubChem CID 132593728) has the molecular formula C14H18N4O6 and a molecular weight of 338.32 g/mol. Its IUPAC name is N-hydroxy-4-[(2-methylcyclohexyl)amino]-3,5-dinitrobenzamide.
| Compound Name | N-hydroxy-4-[(2-methylcyclohexyl)amino]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 132593728 |
| Molecular Formula | C14H18N4O6 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | N-hydroxy-4-[(2-methylcyclohexyl)amino]-3,5-dinitrobenzamide |
| SMILES | CC1CCCCC1Nc1c([N+](=O)[O-])cc(C(=O)NO)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H18N4O6/c1-8-4-2-3-5-10(8)15-13-11(17(21)22)6-9(14(19)16-20)7-12(13)18(23)24/h6-8,10,15,20H,2-5H2,1H3,(H,16,19) |
| InChIKey | QASGNEPPBMBEDK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 147.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|