C20H19F2N3O4 — CID 55838280
3-fluoro-N-[1-(2-fluorobenzoyl)piperidin-4-yl]-4-methyl-5-nitrobenzamide (PubChem CID 55838280) has the molecular formula C20H19F2N3O4 and a molecular weight of 403.39 g/mol. Its IUPAC name is 3-fluoro-N-[1-(2-fluorobenzoyl)piperidin-4-yl]-4-methyl-5-nitrobenzamide.
| Compound Name | 3-fluoro-N-[1-(2-fluorobenzoyl)piperidin-4-yl]-4-methyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 55838280 |
| Molecular Formula | C20H19F2N3O4 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 3-fluoro-N-[1-(2-fluorobenzoyl)piperidin-4-yl]-4-methyl-5-nitrobenzamide |
| SMILES | Cc1c(F)cc(C(=O)NC2CCN(C(=O)c3ccccc3F)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H19F2N3O4/c1-12-17(22)10-13(11-18(12)25(28)29)19(26)23-14-6-8-24(9-7-14)20(27)15-4-2-3-5-16(15)21/h2-5,10-11,14H,6-9H2,1H3,(H,23,26) |
| InChIKey | RIVFSPMLQULIDN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|