C20H19FN4O6 — CID 78851286
(2-fluorophenyl)-[4-(4-methyl-3,5-dinitrobenzoyl)-1,4-diazepan-1-yl]methanone (PubChem CID 78851286) has the molecular formula C20H19FN4O6 and a molecular weight of 430.39 g/mol. Its IUPAC name is (2-fluorophenyl)-[4-(4-methyl-3,5-dinitrobenzoyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | (2-fluorophenyl)-[4-(4-methyl-3,5-dinitrobenzoyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 78851286 |
| Molecular Formula | C20H19FN4O6 |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | (2-fluorophenyl)-[4-(4-methyl-3,5-dinitrobenzoyl)-1,4-diazepan-1-yl]methanone |
| SMILES | Cc1c([N+](=O)[O-])cc(C(=O)N2CCCN(C(=O)c3ccccc3F)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H19FN4O6/c1-13-17(24(28)29)11-14(12-18(13)25(30)31)19(26)22-7-4-8-23(10-9-22)20(27)15-5-2-3-6-16(15)21/h2-3,5-6,11-12H,4,7-10H2,1H3 |
| InChIKey | GHUBTEUREIIKIF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 126.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|