C20H20FN3O4 — CID 78849851
1-[4-(2-fluorobenzoyl)-1,4-diazepan-1-yl]-2-(2-nitrophenyl)ethanone (PubChem CID 78849851) has the molecular formula C20H20FN3O4 and a molecular weight of 385.40 g/mol. Its IUPAC name is 1-[4-(2-fluorobenzoyl)-1,4-diazepan-1-yl]-2-(2-nitrophenyl)ethanone.
| Compound Name | 1-[4-(2-fluorobenzoyl)-1,4-diazepan-1-yl]-2-(2-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 78849851 |
| Molecular Formula | C20H20FN3O4 |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 1-[4-(2-fluorobenzoyl)-1,4-diazepan-1-yl]-2-(2-nitrophenyl)ethanone |
| SMILES | O=C(Cc1ccccc1[N+](=O)[O-])N1CCCN(C(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C20H20FN3O4/c21-17-8-3-2-7-16(17)20(26)23-11-5-10-22(12-13-23)19(25)14-15-6-1-4-9-18(15)24(27)28/h1-4,6-9H,5,10-14H2 |
| InChIKey | IGUAQWLPSXRMIF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|