C19H20Cl2N4O5S — CID 36723759
[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-[4-(dimethylamino)-3-nitrophenyl]methanone (PubChem CID 36723759) has the molecular formula C19H20Cl2N4O5S and a molecular weight of 487.37 g/mol. Its IUPAC name is [4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-[4-(dimethylamino)-3-nitrophenyl]methanone.
| Compound Name | [4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-[4-(dimethylamino)-3-nitrophenyl]methanone |
|---|---|
| PubChem CID | 36723759 |
| Molecular Formula | C19H20Cl2N4O5S |
| Molecular Weight | 487.37 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | [4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-[4-(dimethylamino)-3-nitrophenyl]methanone |
| SMILES | CN(C)c1ccc(C(=O)N2CCN(S(=O)(=O)c3ccc(Cl)c(Cl)c3)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H20Cl2N4O5S/c1-22(2)17-6-3-13(11-18(17)25(27)28)19(26)23-7-9-24(10-8-23)31(29,30)14-4-5-15(20)16(21)12-14/h3-6,11-12H,7-10H2,1-2H3 |
| InChIKey | JXBQVNLKCISSRB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 104.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|