C23H30N4O5S — CID 26869217
[4-(dimethylamino)-3-nitrophenyl]-[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 26869217) has the molecular formula C23H30N4O5S and a molecular weight of 474.58 g/mol. Its IUPAC name is [4-(dimethylamino)-3-nitrophenyl]-[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | [4-(dimethylamino)-3-nitrophenyl]-[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 26869217 |
| Molecular Formula | C23H30N4O5S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | [4-(dimethylamino)-3-nitrophenyl]-[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N2CCN(C(=O)c3ccc(N(C)C)c([N+](=O)[O-])c3)CC2)c1C |
| InChI | InChI=1S/C23H30N4O5S/c1-15-13-16(2)18(4)22(17(15)3)33(31,32)26-11-9-25(10-12-26)23(28)19-7-8-20(24(5)6)21(14-19)27(29)30/h7-8,13-14H,9-12H2,1-6H3 |
| InChIKey | KVTGRMLUHKXKKW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 104.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|