C19H21N3O2 — CID 18101727
4-benzoyl-N-(3-methylphenyl)piperazine-1-carboxamide (PubChem CID 18101727) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 4-benzoyl-N-(3-methylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-benzoyl-N-(3-methylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 18101727 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 4-benzoyl-N-(3-methylphenyl)piperazine-1-carboxamide |
| SMILES | Cc1cccc(NC(=O)N2CCN(C(=O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C19H21N3O2/c1-15-6-5-9-17(14-15)20-19(24)22-12-10-21(11-13-22)18(23)16-7-3-2-4-8-16/h2-9,14H,10-13H2,1H3,(H,20,24) |
| InChIKey | LMXNZRONKDUNTL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |