C20H23N3O3 — CID 122028905
3-[[4-[(3-methylphenyl)carbamoyl]piperazin-1-yl]methyl]benzoic acid (PubChem CID 122028905) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is 3-[[4-[(3-methylphenyl)carbamoyl]piperazin-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[4-[(3-methylphenyl)carbamoyl]piperazin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 122028905 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 3-[[4-[(3-methylphenyl)carbamoyl]piperazin-1-yl]methyl]benzoic acid |
| SMILES | Cc1cccc(NC(=O)N2CCN(Cc3cccc(C(=O)O)c3)CC2)c1 |
| InChI | InChI=1S/C20H23N3O3/c1-15-4-2-7-18(12-15)21-20(26)23-10-8-22(9-11-23)14-16-5-3-6-17(13-16)19(24)25/h2-7,12-13H,8-11,14H2,1H3,(H,21,26)(H,24,25) |
| InChIKey | DRGHNFZLCHXZNN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |