C11H11FN2O4S — CID 62682000
(3-fluoro-4-nitrophenyl)-(1-oxo-1,4-thiazinan-4-yl)methanone (PubChem CID 62682000) has the molecular formula C11H11FN2O4S and a molecular weight of 286.28 g/mol. Its IUPAC name is (3-fluoro-4-nitrophenyl)-(1-oxo-1,4-thiazinan-4-yl)methanone.
| Compound Name | (3-fluoro-4-nitrophenyl)-(1-oxo-1,4-thiazinan-4-yl)methanone |
|---|---|
| PubChem CID | 62682000 |
| Molecular Formula | C11H11FN2O4S |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | (3-fluoro-4-nitrophenyl)-(1-oxo-1,4-thiazinan-4-yl)methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])c(F)c1)N1CCS(=O)CC1 |
| InChI | InChI=1S/C11H11FN2O4S/c12-9-7-8(1-2-10(9)14(16)17)11(15)13-3-5-19(18)6-4-13/h1-2,7H,3-6H2 |
| InChIKey | VSBZLEMIEITWDS-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|