C25H30FN5O4 — CID 42679634
4-[4-acetamido-2-(morpholine-4-carbonyl)phenyl]-N-(2-fluorophenyl)-1,4-diazepane-1-carboxamide (PubChem CID 42679634) has the molecular formula C25H30FN5O4 and a molecular weight of 483.54 g/mol. Its IUPAC name is 4-[4-acetamido-2-(morpholine-4-carbonyl)phenyl]-N-(2-fluorophenyl)-1,4-diazepane-1-carboxamide.
| Compound Name | 4-[4-acetamido-2-(morpholine-4-carbonyl)phenyl]-N-(2-fluorophenyl)-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 42679634 |
| Molecular Formula | C25H30FN5O4 |
| Molecular Weight | 483.54 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 4-[4-acetamido-2-(morpholine-4-carbonyl)phenyl]-N-(2-fluorophenyl)-1,4-diazepane-1-carboxamide |
| SMILES | CC(=O)Nc1ccc(N2CCCN(C(=O)Nc3ccccc3F)CC2)c(C(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C25H30FN5O4/c1-18(32)27-19-7-8-23(20(17-19)24(33)30-13-15-35-16-14-30)29-9-4-10-31(12-11-29)25(34)28-22-6-3-2-5-21(22)26/h2-3,5-8,17H,4,9-16H2,1H3,(H,27,32)(H,28,34) |
| InChIKey | CCEIOBYQBCYTBP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.54 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|