C23H29FN4O2 — CID 42671655
5-amino-N,N-diethyl-2-[4-(3-fluorobenzoyl)-1,4-diazepan-1-yl]benzamide (PubChem CID 42671655) has the molecular formula C23H29FN4O2 and a molecular weight of 412.51 g/mol. Its IUPAC name is 5-amino-N,N-diethyl-2-[4-(3-fluorobenzoyl)-1,4-diazepan-1-yl]benzamide.
| Compound Name | 5-amino-N,N-diethyl-2-[4-(3-fluorobenzoyl)-1,4-diazepan-1-yl]benzamide |
|---|---|
| PubChem CID | 42671655 |
| Molecular Formula | C23H29FN4O2 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 5-amino-N,N-diethyl-2-[4-(3-fluorobenzoyl)-1,4-diazepan-1-yl]benzamide |
| SMILES | CCN(CC)C(=O)c1cc(N)ccc1N1CCCN(C(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C23H29FN4O2/c1-3-26(4-2)23(30)20-16-19(25)9-10-21(20)27-11-6-12-28(14-13-27)22(29)17-7-5-8-18(24)15-17/h5,7-10,15-16H,3-4,6,11-14,25H2,1-2H3 |
| InChIKey | XLUNANBSJSQJNB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|