C37H40N4O3 — CID 98337892
5-benzamido-N-benzyl-N-methyl-2-[4-[(2R)-2-phenylbutanoyl]-1,4-diazepan-1-yl]benzamide (PubChem CID 98337892) has the molecular formula C37H40N4O3 and a molecular weight of 588.75 g/mol. Its IUPAC name is 5-benzamido-N-benzyl-N-methyl-2-[4-[(2R)-2-phenylbutanoyl]-1,4-diazepan-1-yl]benzamide.
| Compound Name | 5-benzamido-N-benzyl-N-methyl-2-[4-[(2R)-2-phenylbutanoyl]-1,4-diazepan-1-yl]benzamide |
|---|---|
| PubChem CID | 98337892 |
| Molecular Formula | C37H40N4O3 |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 588.31 |
| IUPAC Name | 5-benzamido-N-benzyl-N-methyl-2-[4-[(2R)-2-phenylbutanoyl]-1,4-diazepan-1-yl]benzamide |
| SMILES | CC[C@@H](C(=O)N1CCCN(c2ccc(NC(=O)c3ccccc3)cc2C(=O)N(C)Cc2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C37H40N4O3/c1-3-32(29-16-9-5-10-17-29)37(44)41-23-13-22-40(24-25-41)34-21-20-31(38-35(42)30-18-11-6-12-19-30)26-33(34)36(43)39(2)27-28-14-7-4-8-15-28/h4-12,14-21,26,32H,3,13,22-25,27H2,1-2H3,(H,38,42)/t32-/m1/s1 |
| InChIKey | HFUJWQXBPPLTSM-JGCGQSQUSA-N |
| XLogP | 6.44 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|