C30H43N5O3 — CID 93142321
N,N-diethyl-2-[4-[(2S)-2-phenylbutanoyl]-1,4-diazepan-1-yl]-5-(propylcarbamoylamino)benzamide (PubChem CID 93142321) has the molecular formula C30H43N5O3 and a molecular weight of 521.71 g/mol. Its IUPAC name is N,N-diethyl-2-[4-[(2S)-2-phenylbutanoyl]-1,4-diazepan-1-yl]-5-(propylcarbamoylamino)benzamide.
| Compound Name | N,N-diethyl-2-[4-[(2S)-2-phenylbutanoyl]-1,4-diazepan-1-yl]-5-(propylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 93142321 |
| Molecular Formula | C30H43N5O3 |
| Molecular Weight | 521.71 g/mol |
| Exact Mass | 521.34 |
| IUPAC Name | N,N-diethyl-2-[4-[(2S)-2-phenylbutanoyl]-1,4-diazepan-1-yl]-5-(propylcarbamoylamino)benzamide |
| SMILES | CCCNC(=O)Nc1ccc(N2CCCN(C(=O)[C@@H](CC)c3ccccc3)CC2)c(C(=O)N(CC)CC)c1 |
| InChI | InChI=1S/C30H43N5O3/c1-5-17-31-30(38)32-24-15-16-27(26(22-24)29(37)33(7-3)8-4)34-18-12-19-35(21-20-34)28(36)25(6-2)23-13-10-9-11-14-23/h9-11,13-16,22,25H,5-8,12,17-21H2,1-4H3,(H2,31,32,38)/t25-/m0/s1 |
| InChIKey | IXEHKMWOHNFUSQ-VWLOTQADSA-N |
| XLogP | 4.93 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.71 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|