C33H36N4O5 — CID 42673232
N-[3-[benzyl(methyl)carbamoyl]-4-[4-(cyclopentanecarbonyl)piperazin-1-yl]phenyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 42673232) has the molecular formula C33H36N4O5 and a molecular weight of 568.67 g/mol. Its IUPAC name is N-[3-[benzyl(methyl)carbamoyl]-4-[4-(cyclopentanecarbonyl)piperazin-1-yl]phenyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[3-[benzyl(methyl)carbamoyl]-4-[4-(cyclopentanecarbonyl)piperazin-1-yl]phenyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 42673232 |
| Molecular Formula | C33H36N4O5 |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.27 |
| IUPAC Name | N-[3-[benzyl(methyl)carbamoyl]-4-[4-(cyclopentanecarbonyl)piperazin-1-yl]phenyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1cc(NC(=O)c2ccc3c(c2)OCO3)ccc1N1CCN(C(=O)C2CCCC2)CC1 |
| InChI | InChI=1S/C33H36N4O5/c1-35(21-23-7-3-2-4-8-23)33(40)27-20-26(34-31(38)25-11-14-29-30(19-25)42-22-41-29)12-13-28(27)36-15-17-37(18-16-36)32(39)24-9-5-6-10-24/h2-4,7-8,11-14,19-20,24H,5-6,9-10,15-18,21-22H2,1H3,(H,34,38) |
| InChIKey | UBHGIBODSZFRQZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|