C22H28N4O4S — CID 46363267
2-[4-[2-(tert-butylamino)-2-oxoethyl]piperazin-1-yl]-5-(thiophene-2-carbonylamino)benzoic acid (PubChem CID 46363267) has the molecular formula C22H28N4O4S and a molecular weight of 444.56 g/mol. Its IUPAC name is 2-[4-[2-(tert-butylamino)-2-oxoethyl]piperazin-1-yl]-5-(thiophene-2-carbonylamino)benzoic acid.
| Compound Name | 2-[4-[2-(tert-butylamino)-2-oxoethyl]piperazin-1-yl]-5-(thiophene-2-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 46363267 |
| Molecular Formula | C22H28N4O4S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 2-[4-[2-(tert-butylamino)-2-oxoethyl]piperazin-1-yl]-5-(thiophene-2-carbonylamino)benzoic acid |
| SMILES | CC(C)(C)NC(=O)CN1CCN(c2ccc(NC(=O)c3cccs3)cc2C(=O)O)CC1 |
| InChI | InChI=1S/C22H28N4O4S/c1-22(2,3)24-19(27)14-25-8-10-26(11-9-25)17-7-6-15(13-16(17)21(29)30)23-20(28)18-5-4-12-31-18/h4-7,12-13H,8-11,14H2,1-3H3,(H,23,28)(H,24,27)(H,29,30) |
| InChIKey | STVFBRLALSVCOT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|