C30H33FN4O3 — CID 93144669
5-acetamido-N-[(4-fluorophenyl)methyl]-2-[4-[(2S)-2-phenylbutanoyl]piperazin-1-yl]benzamide (PubChem CID 93144669) has the molecular formula C30H33FN4O3 and a molecular weight of 516.62 g/mol. Its IUPAC name is 5-acetamido-N-[(4-fluorophenyl)methyl]-2-[4-[(2S)-2-phenylbutanoyl]piperazin-1-yl]benzamide.
| Compound Name | 5-acetamido-N-[(4-fluorophenyl)methyl]-2-[4-[(2S)-2-phenylbutanoyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 93144669 |
| Molecular Formula | C30H33FN4O3 |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | 5-acetamido-N-[(4-fluorophenyl)methyl]-2-[4-[(2S)-2-phenylbutanoyl]piperazin-1-yl]benzamide |
| SMILES | CC[C@H](C(=O)N1CCN(c2ccc(NC(C)=O)cc2C(=O)NCc2ccc(F)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C30H33FN4O3/c1-3-26(23-7-5-4-6-8-23)30(38)35-17-15-34(16-18-35)28-14-13-25(33-21(2)36)19-27(28)29(37)32-20-22-9-11-24(31)12-10-22/h4-14,19,26H,3,15-18,20H2,1-2H3,(H,32,37)(H,33,36)/t26-/m0/s1 |
| InChIKey | JYLVQAQLQVNFOS-SANMLTNESA-N |
| XLogP | 4.56 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|