C21H25FN4O2 — CID 1065616
5-(ethylcarbamoylamino)-N-[(4-fluorophenyl)methyl]-2-pyrrolidin-1-ylbenzamide (PubChem CID 1065616) has the molecular formula C21H25FN4O2 and a molecular weight of 384.46 g/mol. Its IUPAC name is 5-(ethylcarbamoylamino)-N-[(4-fluorophenyl)methyl]-2-pyrrolidin-1-ylbenzamide.
| Compound Name | 5-(ethylcarbamoylamino)-N-[(4-fluorophenyl)methyl]-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 1065616 |
| Molecular Formula | C21H25FN4O2 |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 5-(ethylcarbamoylamino)-N-[(4-fluorophenyl)methyl]-2-pyrrolidin-1-ylbenzamide |
| SMILES | CCNC(=O)Nc1ccc(N2CCCC2)c(C(=O)NCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C21H25FN4O2/c1-2-23-21(28)25-17-9-10-19(26-11-3-4-12-26)18(13-17)20(27)24-14-15-5-7-16(22)8-6-15/h5-10,13H,2-4,11-12,14H2,1H3,(H,24,27)(H2,23,25,28) |
| InChIKey | LVEMYORYACTQIW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|