C33H38N4O4 — CID 42678519
3-methoxy-N-[4-[4-(4-methylbenzoyl)-1,4-diazepan-1-yl]-3-(piperidine-1-carbonyl)phenyl]benzamide (PubChem CID 42678519) has the molecular formula C33H38N4O4 and a molecular weight of 554.69 g/mol. Its IUPAC name is 3-methoxy-N-[4-[4-(4-methylbenzoyl)-1,4-diazepan-1-yl]-3-(piperidine-1-carbonyl)phenyl]benzamide.
| Compound Name | 3-methoxy-N-[4-[4-(4-methylbenzoyl)-1,4-diazepan-1-yl]-3-(piperidine-1-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 42678519 |
| Molecular Formula | C33H38N4O4 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | 3-methoxy-N-[4-[4-(4-methylbenzoyl)-1,4-diazepan-1-yl]-3-(piperidine-1-carbonyl)phenyl]benzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc(N3CCCN(C(=O)c4ccc(C)cc4)CC3)c(C(=O)N3CCCCC3)c2)c1 |
| InChI | InChI=1S/C33H38N4O4/c1-24-10-12-25(13-11-24)32(39)37-19-7-18-35(20-21-37)30-15-14-27(23-29(30)33(40)36-16-4-3-5-17-36)34-31(38)26-8-6-9-28(22-26)41-2/h6,8-15,22-23H,3-5,7,16-21H2,1-2H3,(H,34,38) |
| InChIKey | MIPHGYGYJYHCHU-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|